C16H13NO4 — CID 19863011
3-(4-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 19863011) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(4-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19863011 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-(4-phenoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)C1CC(c2ccc(Oc3ccccc3)cc2)=NO1 |
| InChI | InChI=1S/C16H13NO4/c18-16(19)15-10-14(17-21-15)11-6-8-13(9-7-11)20-12-4-2-1-3-5-12/h1-9,15H,10H2,(H,18,19) |
| InChIKey | FVPNSCCZTXKYKW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |