3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid

C10H7Br2NO3 — CID 19863025

IUPAC3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1CC(c2ccc(Br)c(Br)c2)=NO1
InChIInChI=1S/C10H7Br2NO3/c11-6-2-1-5(3-7(6)12)8-4-9(10(14)15)16-13-8/h1-3,9H,4H2,(H,14,15)
InChIKeyOFLOTPBEQSENSX-UHFFFAOYSA-N
MW348.98 g/mol
LogP2.79
Rot. Bonds2

About 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid

3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 19863025) has the molecular formula C10H7Br2NO3 and a molecular weight of 348.98 g/mol. Its IUPAC name is 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid
PubChem CID19863025
Molecular FormulaC10H7Br2NO3
Molecular Weight348.98 g/mol
Exact Mass346.88
IUPAC Name3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1CC(c2ccc(Br)c(Br)c2)=NO1
InChIInChI=1S/C10H7Br2NO3/c11-6-2-1-5(3-7(6)12)8-4-9(10(14)15)16-13-8/h1-3,9H,4H2,(H,14,15)
InChIKeyOFLOTPBEQSENSX-UHFFFAOYSA-N
XLogP2.79
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.98
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CID 19863025) is 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid is O=C(O)C1CC(c2ccc(Br)c(Br)c2)=NO1.
What is the InChIKey of 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The InChIKey is OFLOTPBEQSENSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Br2NO3/c11-6-2-1-5(3-7(6)12)8-4-9(10(14)15)16-13-8/h1-3,9H,4H2,(H,14,15).
What are the key properties of 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid has a molecular weight of 348.98 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dibromophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 19863025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).