About 1-(2-methylbutyl)pyrrole
1-(2-methylbutyl)pyrrole (PubChem CID 19863975) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-(2-methylbutyl)pyrrole.
Molecular Properties
| Compound Name | 1-(2-methylbutyl)pyrrole |
| PubChem CID | 19863975 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1-(2-methylbutyl)pyrrole |
| SMILES | CCC(C)Cn1cccc1 |
| InChI | InChI=1S/C9H15N/c1-3-9(2)8-10-6-4-5-7-10/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | WRPDLXFMIRJRFM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-methylbutyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylbutyl)pyrrole?
The IUPAC name of 1-(2-methylbutyl)pyrrole (CID 19863975) is 1-(2-methylbutyl)pyrrole.
What is the SMILES notation for 1-(2-methylbutyl)pyrrole?
The canonical SMILES for 1-(2-methylbutyl)pyrrole is CCC(C)Cn1cccc1.
What is the InChIKey of 1-(2-methylbutyl)pyrrole?
The InChIKey is WRPDLXFMIRJRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-9(2)8-10-6-4-5-7-10/h4-7,9H,3,8H2,1-2H3.
What are the key properties of 1-(2-methylbutyl)pyrrole?
1-(2-methylbutyl)pyrrole has a molecular weight of 137.23 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylbutyl)pyrrole is sourced from PubChem (CID 19863975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).