C14H22O6S4 — CID 19864001
2,3,5,6-tetrakis(2-hydroxyethylsulfanyl)benzene-1,4-diol (PubChem CID 19864001) has the molecular formula C14H22O6S4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(2-hydroxyethylsulfanyl)benzene-1,4-diol.
| Compound Name | 2,3,5,6-tetrakis(2-hydroxyethylsulfanyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 19864001 |
| Molecular Formula | C14H22O6S4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2,3,5,6-tetrakis(2-hydroxyethylsulfanyl)benzene-1,4-diol |
| SMILES | OCCSc1c(O)c(SCCO)c(SCCO)c(O)c1SCCO |
| InChI | InChI=1S/C14H22O6S4/c15-1-5-21-11-9(19)13(23-7-3-17)14(24-8-4-18)10(20)12(11)22-6-2-16/h15-20H,1-8H2 |
| InChIKey | TVWFLXROQJHXHN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|