About (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone
(1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 19864016) has the molecular formula C13H10F2O
and a molecular weight of 220.22 g/mol. Its IUPAC name is (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone |
| PubChem CID | 19864016 |
| Molecular Formula | C13H10F2O |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(F)C=CC(F)=CC1 |
| InChI | InChI=1S/C13H10F2O/c14-11-6-8-13(15,9-7-11)12(16)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | FDQJEGGUPFESSJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone?
The IUPAC name of (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone (CID 19864016) is (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone.
What is the SMILES notation for (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone?
The canonical SMILES for (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone is O=C(c1ccccc1)C1(F)C=CC(F)=CC1.
What is the InChIKey of (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone?
The InChIKey is FDQJEGGUPFESSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2O/c14-11-6-8-13(15,9-7-11)12(16)10-4-2-1-3-5-10/h1-8H,9H2.
What are the key properties of (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone?
(1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone has a molecular weight of 220.22 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-difluorocyclohexa-2,4-dien-1-yl)-phenylmethanone is sourced from PubChem (CID 19864016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).