About 1-N,1-N'-dimethylethene-1,1,2-triamine
1-N,1-N'-dimethylethene-1,1,2-triamine (PubChem CID 19864728) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is 1-N,1-N'-dimethylethene-1,1,2-triamine.
Molecular Properties
| Compound Name | 1-N,1-N'-dimethylethene-1,1,2-triamine |
| PubChem CID | 19864728 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 1-N,1-N'-dimethylethene-1,1,2-triamine |
| SMILES | CNC(=CN)NC |
| InChI | InChI=1S/C4H11N3/c1-6-4(3-5)7-2/h3,6-7H,5H2,1-2H3 |
| InChIKey | MUDAUTARLYMRPP-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N,1-N'-dimethylethene-1,1,2-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N'-dimethylethene-1,1,2-triamine?
The IUPAC name of 1-N,1-N'-dimethylethene-1,1,2-triamine (CID 19864728) is 1-N,1-N'-dimethylethene-1,1,2-triamine.
What is the SMILES notation for 1-N,1-N'-dimethylethene-1,1,2-triamine?
The canonical SMILES for 1-N,1-N'-dimethylethene-1,1,2-triamine is CNC(=CN)NC.
What is the InChIKey of 1-N,1-N'-dimethylethene-1,1,2-triamine?
The InChIKey is MUDAUTARLYMRPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3/c1-6-4(3-5)7-2/h3,6-7H,5H2,1-2H3.
What are the key properties of 1-N,1-N'-dimethylethene-1,1,2-triamine?
1-N,1-N'-dimethylethene-1,1,2-triamine has a molecular weight of 101.15 g/mol, XLogP of -0.82, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N'-dimethylethene-1,1,2-triamine is sourced from PubChem (CID 19864728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).