About methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate
methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate (PubChem CID 19864962) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate.
Molecular Properties
| Compound Name | methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate |
| PubChem CID | 19864962 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate |
| SMILES | COC(=O)CCCC(C)(C)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C16H24O3/c1-11-9-12(2)15(18)13(10-11)16(3,4)8-6-7-14(17)19-5/h9-10,18H,6-8H2,1-5H3 |
| InChIKey | MVPXLZQYNIIGTF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate?
The IUPAC name of methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate (CID 19864962) is methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate.
What is the SMILES notation for methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate?
The canonical SMILES for methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate is COC(=O)CCCC(C)(C)c1cc(C)cc(C)c1O.
What is the InChIKey of methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate?
The InChIKey is MVPXLZQYNIIGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-11-9-12(2)15(18)13(10-11)16(3,4)8-6-7-14(17)19-5/h9-10,18H,6-8H2,1-5H3.
What are the key properties of methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate?
methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate has a molecular weight of 264.37 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2-hydroxy-3,5-dimethylphenyl)-5-methylhexanoate is sourced from PubChem (CID 19864962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).