About 5-methyloxolan-2-one;oxan-2-one
5-methyloxolan-2-one;oxan-2-one (PubChem CID 19865139) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 5-methyloxolan-2-one;oxan-2-one.
Molecular Properties
| Compound Name | 5-methyloxolan-2-one;oxan-2-one |
| PubChem CID | 19865139 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5-methyloxolan-2-one;oxan-2-one |
| SMILES | CC1CCC(=O)O1.O=C1CCCCO1 |
| InChI | InChI=1S/2C5H8O2/c1-4-2-3-5(6)7-4;6-5-3-1-2-4-7-5/h4H,2-3H2,1H3;1-4H2 |
| InChIKey | WRDUIAFIIWGBBN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyloxolan-2-one;oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyloxolan-2-one;oxan-2-one?
The IUPAC name of 5-methyloxolan-2-one;oxan-2-one (CID 19865139) is 5-methyloxolan-2-one;oxan-2-one.
What is the SMILES notation for 5-methyloxolan-2-one;oxan-2-one?
The canonical SMILES for 5-methyloxolan-2-one;oxan-2-one is CC1CCC(=O)O1.O=C1CCCCO1.
What is the InChIKey of 5-methyloxolan-2-one;oxan-2-one?
The InChIKey is WRDUIAFIIWGBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8O2/c1-4-2-3-5(6)7-4;6-5-3-1-2-4-7-5/h4H,2-3H2,1H3;1-4H2.
What are the key properties of 5-methyloxolan-2-one;oxan-2-one?
5-methyloxolan-2-one;oxan-2-one has a molecular weight of 200.23 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyloxolan-2-one;oxan-2-one is sourced from PubChem (CID 19865139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).