C9H16N2 — CID 19865901
2-pyrrolidin-1-yl-2,3,4,5-tetrahydropyridine (PubChem CID 19865901) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-2,3,4,5-tetrahydropyridine.
| Compound Name | 2-pyrrolidin-1-yl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 19865901 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-pyrrolidin-1-yl-2,3,4,5-tetrahydropyridine |
| SMILES | C1=NC(N2CCCC2)CCC1 |
| InChI | InChI=1S/C9H16N2/c1-2-6-10-9(5-1)11-7-3-4-8-11/h6,9H,1-5,7-8H2 |
| InChIKey | YWKWWXPNNXQCFZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |