About 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial
2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial (PubChem CID 19866389) has the molecular formula C9H12NO5+
and a molecular weight of 214.20 g/mol. Its IUPAC name is 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial.
Molecular Properties
| Compound Name | 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial |
| PubChem CID | 19866389 |
| Molecular Formula | C9H12NO5+ |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial |
| SMILES | O=CCCC(C=O)[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C9H12NO5/c11-5-1-2-7(6-12)10(15)8(13)3-4-9(10)14/h5-7,15H,1-4H2/q+1 |
| InChIKey | VHIZNXPAKBSWJT-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial?
The IUPAC name of 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial (CID 19866389) is 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial.
What is the SMILES notation for 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial?
The canonical SMILES for 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial is O=CCCC(C=O)[N+]1(O)C(=O)CCC1=O.
What is the InChIKey of 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial?
The InChIKey is VHIZNXPAKBSWJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO5/c11-5-1-2-7(6-12)10(15)8(13)3-4-9(10)14/h5-7,15H,1-4H2/q+1.
What are the key properties of 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial?
2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial has a molecular weight of 214.20 g/mol, XLogP of -0.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pentanedial is sourced from PubChem (CID 19866389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).