About 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline
2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline (PubChem CID 19866674) has the molecular formula C15H15N3O3S
and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline.
Molecular Properties
| Compound Name | 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline |
| PubChem CID | 19866674 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline |
| SMILES | COc1cc2nc(S(=O)c3ccccc3N)[nH]c2cc1OC |
| InChI | InChI=1S/C15H15N3O3S/c1-20-12-7-10-11(8-13(12)21-2)18-15(17-10)22(19)14-6-4-3-5-9(14)16/h3-8H,16H2,1-2H3,(H,17,18) |
| InChIKey | LIKMGAGHCYMHTE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline?
The IUPAC name of 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline (CID 19866674) is 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline.
What is the SMILES notation for 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline?
The canonical SMILES for 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline is COc1cc2nc(S(=O)c3ccccc3N)[nH]c2cc1OC.
What is the InChIKey of 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline?
The InChIKey is LIKMGAGHCYMHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3S/c1-20-12-7-10-11(8-13(12)21-2)18-15(17-10)22(19)14-6-4-3-5-9(14)16/h3-8H,16H2,1-2H3,(H,17,18).
What are the key properties of 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline?
2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline has a molecular weight of 317.37 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfinyl]aniline is sourced from PubChem (CID 19866674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).