About 2-chloro-3,4,6-trimethylpyridine
2-chloro-3,4,6-trimethylpyridine (PubChem CID 19867372) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 2-chloro-3,4,6-trimethylpyridine.
Molecular Properties
| Compound Name | 2-chloro-3,4,6-trimethylpyridine |
| PubChem CID | 19867372 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 2-chloro-3,4,6-trimethylpyridine |
| SMILES | Cc1cc(C)c(C)c(Cl)n1 |
| InChI | InChI=1S/C8H10ClN/c1-5-4-6(2)10-8(9)7(5)3/h4H,1-3H3 |
| InChIKey | CKFAUGYTGXHEGN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,4,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,4,6-trimethylpyridine?
The IUPAC name of 2-chloro-3,4,6-trimethylpyridine (CID 19867372) is 2-chloro-3,4,6-trimethylpyridine.
What is the SMILES notation for 2-chloro-3,4,6-trimethylpyridine?
The canonical SMILES for 2-chloro-3,4,6-trimethylpyridine is Cc1cc(C)c(C)c(Cl)n1.
What is the InChIKey of 2-chloro-3,4,6-trimethylpyridine?
The InChIKey is CKFAUGYTGXHEGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN/c1-5-4-6(2)10-8(9)7(5)3/h4H,1-3H3.
What are the key properties of 2-chloro-3,4,6-trimethylpyridine?
2-chloro-3,4,6-trimethylpyridine has a molecular weight of 155.63 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,4,6-trimethylpyridine is sourced from PubChem (CID 19867372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).