About N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide
N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide (PubChem CID 19867677) has the molecular formula C22H21ClN4O3
and a molecular weight of 424.89 g/mol. Its IUPAC name is N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide |
| PubChem CID | 19867677 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide |
| SMILES | CC(=O)NCCCCOC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C22H21ClN4O3/c1-14(28)24-12-4-5-13-30-22-17-7-3-2-6-16(17)21(29)27(22)19-11-9-15-8-10-18(23)25-20(15)26-19/h2-3,6-11,22H,4-5,12-13H2,1H3,(H,24,28) |
| InChIKey | KRVFWZURGHWOBL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide?
The IUPAC name of N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide (CID 19867677) is N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide.
What is the SMILES notation for N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide?
The canonical SMILES for N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide is CC(=O)NCCCCOC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1.
What is the InChIKey of N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide?
The InChIKey is KRVFWZURGHWOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN4O3/c1-14(28)24-12-4-5-13-30-22-17-7-3-2-6-16(17)21(29)27(22)19-11-9-15-8-10-18(23)25-20(15)26-19/h2-3,6-11,22H,4-5,12-13H2,1H3,(H,24,28).
What are the key properties of N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide?
N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide has a molecular weight of 424.89 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl]oxy]butyl]acetamide is sourced from PubChem (CID 19867677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).