About 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine
2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine (PubChem CID 19867692) has the molecular formula C16H11Cl2N3
and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine |
| PubChem CID | 19867692 |
| Molecular Formula | C16H11Cl2N3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine |
| SMILES | Clc1ccc2ccc(N3Cc4ccccc4C3Cl)nc2n1 |
| InChI | InChI=1S/C16H11Cl2N3/c17-13-7-5-10-6-8-14(20-16(10)19-13)21-9-11-3-1-2-4-12(11)15(21)18/h1-8,15H,9H2 |
| InChIKey | IKXNAAZNNMTZST-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine?
The IUPAC name of 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine (CID 19867692) is 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine.
What is the SMILES notation for 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine?
The canonical SMILES for 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine is Clc1ccc2ccc(N3Cc4ccccc4C3Cl)nc2n1.
What is the InChIKey of 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine?
The InChIKey is IKXNAAZNNMTZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N3/c17-13-7-5-10-6-8-14(20-16(10)19-13)21-9-11-3-1-2-4-12(11)15(21)18/h1-8,15H,9H2.
What are the key properties of 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine?
2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine has a molecular weight of 316.19 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-(1-chloro-1,3-dihydroisoindol-2-yl)-1,8-naphthyridine is sourced from PubChem (CID 19867692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).