About 3a,4-dihydro-1H-imidazo[4,5-b]pyridine
3a,4-dihydro-1H-imidazo[4,5-b]pyridine (PubChem CID 19867707) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 3a,4-dihydro-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3a,4-dihydro-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 19867707 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 3a,4-dihydro-1H-imidazo[4,5-b]pyridine |
| SMILES | C1=CNC2N=CNC2=C1 |
| InChI | InChI=1S/C6H7N3/c1-2-5-6(7-3-1)9-4-8-5/h1-4,6-7H,(H,8,9) |
| InChIKey | GRSIQOSWYNULOM-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a,4-dihydro-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4-dihydro-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 3a,4-dihydro-1H-imidazo[4,5-b]pyridine (CID 19867707) is 3a,4-dihydro-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 3a,4-dihydro-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 3a,4-dihydro-1H-imidazo[4,5-b]pyridine is C1=CNC2N=CNC2=C1.
What is the InChIKey of 3a,4-dihydro-1H-imidazo[4,5-b]pyridine?
The InChIKey is GRSIQOSWYNULOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-2-5-6(7-3-1)9-4-8-5/h1-4,6-7H,(H,8,9).
What are the key properties of 3a,4-dihydro-1H-imidazo[4,5-b]pyridine?
3a,4-dihydro-1H-imidazo[4,5-b]pyridine has a molecular weight of 121.14 g/mol, XLogP of -0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4-dihydro-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 19867707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).