About 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide
2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide (PubChem CID 19867806) has the molecular formula C17H15ClN2O2
and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide |
| PubChem CID | 19867806 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1cc(Cl)cc2c(-c3ccccc3)onc12 |
| InChI | InChI=1S/C17H15ClN2O2/c1-20(2)15(21)9-12-8-13(18)10-14-16(12)19-22-17(14)11-6-4-3-5-7-11/h3-8,10H,9H2,1-2H3 |
| InChIKey | OLJJWNMHJQJCDL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide (CID 19867806) is 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide is CN(C)C(=O)Cc1cc(Cl)cc2c(-c3ccccc3)onc12.
What is the InChIKey of 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide?
The InChIKey is OLJJWNMHJQJCDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O2/c1-20(2)15(21)9-12-8-13(18)10-14-16(12)19-22-17(14)11-6-4-3-5-7-11/h3-8,10H,9H2,1-2H3.
What are the key properties of 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide?
2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide has a molecular weight of 314.77 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-3-phenyl-2,1-benzoxazol-7-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 19867806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).