About 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate
2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate (PubChem CID 19867845) has the molecular formula C21H28INO3
and a molecular weight of 469.36 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate.
Molecular Properties
| Compound Name | 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate |
| PubChem CID | 19867845 |
| Molecular Formula | C21H28INO3 |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate |
| SMILES | COc1cc(C#Cc2ccccc2)c(CC[N+](C)(C)C)cc1OC.O.[I-] |
| InChI | InChI=1S/C21H26NO2.HI.H2O/c1-22(2,3)14-13-19-16-21(24-5)20(23-4)15-18(19)12-11-17-9-7-6-8-10-17;;/h6-10,15-16H,13-14H2,1-5H3;1H;1H2/q+1;;/p-1 |
| InChIKey | UBCNSRXLWOHWMT-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 49.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate?
The IUPAC name of 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate (CID 19867845) is 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate.
What is the SMILES notation for 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate?
The canonical SMILES for 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate is COc1cc(C#Cc2ccccc2)c(CC[N+](C)(C)C)cc1OC.O.[I-].
What is the InChIKey of 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate?
The InChIKey is UBCNSRXLWOHWMT-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H26NO2.HI.H2O/c1-22(2,3)14-13-19-16-21(24-5)20(23-4)15-18(19)12-11-17-9-7-6-8-10-17;;/h6-10,15-16H,13-14H2,1-5H3;1H;1H2/q+1;;/p-1.
What are the key properties of 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate?
2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate has a molecular weight of 469.36 g/mol, XLogP of -0.47, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethyl-trimethylazanium;iodide;hydrate is sourced from PubChem (CID 19867845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).