About 6-fluoro-2,5-dimethylquinoline
6-fluoro-2,5-dimethylquinoline (PubChem CID 19868176) has the molecular formula C11H10FN
and a molecular weight of 175.21 g/mol. Its IUPAC name is 6-fluoro-2,5-dimethylquinoline.
Molecular Properties
| Compound Name | 6-fluoro-2,5-dimethylquinoline |
| PubChem CID | 19868176 |
| Molecular Formula | C11H10FN |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 6-fluoro-2,5-dimethylquinoline |
| SMILES | Cc1ccc2c(C)c(F)ccc2n1 |
| InChI | InChI=1S/C11H10FN/c1-7-3-4-9-8(2)10(12)5-6-11(9)13-7/h3-6H,1-2H3 |
| InChIKey | ATWVWVWZFFCWOV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-2,5-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,5-dimethylquinoline?
The IUPAC name of 6-fluoro-2,5-dimethylquinoline (CID 19868176) is 6-fluoro-2,5-dimethylquinoline.
What is the SMILES notation for 6-fluoro-2,5-dimethylquinoline?
The canonical SMILES for 6-fluoro-2,5-dimethylquinoline is Cc1ccc2c(C)c(F)ccc2n1.
What is the InChIKey of 6-fluoro-2,5-dimethylquinoline?
The InChIKey is ATWVWVWZFFCWOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN/c1-7-3-4-9-8(2)10(12)5-6-11(9)13-7/h3-6H,1-2H3.
What are the key properties of 6-fluoro-2,5-dimethylquinoline?
6-fluoro-2,5-dimethylquinoline has a molecular weight of 175.21 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,5-dimethylquinoline is sourced from PubChem (CID 19868176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).