About 1-iodo-3-nitropyrazole
1-iodo-3-nitropyrazole (PubChem CID 19869226) has the molecular formula C3H2IN3O2
and a molecular weight of 238.97 g/mol. Its IUPAC name is 1-iodo-3-nitropyrazole.
Molecular Properties
| Compound Name | 1-iodo-3-nitropyrazole |
| PubChem CID | 19869226 |
| Molecular Formula | C3H2IN3O2 |
| Molecular Weight | 238.97 g/mol |
| Exact Mass | 238.92 |
| IUPAC Name | 1-iodo-3-nitropyrazole |
| SMILES | O=[N+]([O-])c1ccn(I)n1 |
| InChI | InChI=1S/C3H2IN3O2/c4-6-2-1-3(5-6)7(8)9/h1-2H |
| InChIKey | PMIBJGQHYGFFJA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.97 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-3-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-3-nitropyrazole?
The IUPAC name of 1-iodo-3-nitropyrazole (CID 19869226) is 1-iodo-3-nitropyrazole.
What is the SMILES notation for 1-iodo-3-nitropyrazole?
The canonical SMILES for 1-iodo-3-nitropyrazole is O=[N+]([O-])c1ccn(I)n1.
What is the InChIKey of 1-iodo-3-nitropyrazole?
The InChIKey is PMIBJGQHYGFFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2IN3O2/c4-6-2-1-3(5-6)7(8)9/h1-2H.
What are the key properties of 1-iodo-3-nitropyrazole?
1-iodo-3-nitropyrazole has a molecular weight of 238.97 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-3-nitropyrazole is sourced from PubChem (CID 19869226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).