About N,N-dihydroxybutan-1-amine
N,N-dihydroxybutan-1-amine (PubChem CID 19871364) has the molecular formula C4H11NO2
and a molecular weight of 105.14 g/mol. Its IUPAC name is N,N-dihydroxybutan-1-amine.
Molecular Properties
| Compound Name | N,N-dihydroxybutan-1-amine |
| PubChem CID | 19871364 |
| Molecular Formula | C4H11NO2 |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.08 |
| IUPAC Name | N,N-dihydroxybutan-1-amine |
| SMILES | CCCCN(O)O |
| InChI | InChI=1S/C4H11NO2/c1-2-3-4-5(6)7/h6-7H,2-4H2,1H3 |
| InChIKey | MCVIWJKUKOOXNZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihydroxybutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihydroxybutan-1-amine?
The IUPAC name of N,N-dihydroxybutan-1-amine (CID 19871364) is N,N-dihydroxybutan-1-amine.
What is the SMILES notation for N,N-dihydroxybutan-1-amine?
The canonical SMILES for N,N-dihydroxybutan-1-amine is CCCCN(O)O.
What is the InChIKey of N,N-dihydroxybutan-1-amine?
The InChIKey is MCVIWJKUKOOXNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2/c1-2-3-4-5(6)7/h6-7H,2-4H2,1H3.
What are the key properties of N,N-dihydroxybutan-1-amine?
N,N-dihydroxybutan-1-amine has a molecular weight of 105.14 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihydroxybutan-1-amine is sourced from PubChem (CID 19871364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).