C12H24N6 — CID 19871398
1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-triamine (PubChem CID 19871398) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-triamine.
| Compound Name | 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-triamine |
|---|---|
| PubChem CID | 19871398 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-triamine |
| SMILES | C=CCN1C(N)N(CC=C)C(N)N(CC=C)C1N |
| InChI | InChI=1S/C12H24N6/c1-4-7-16-10(13)17(8-5-2)12(15)18(9-6-3)11(16)14/h4-6,10-12H,1-3,7-9,13-15H2 |
| InChIKey | WNYHXAXDUUENSJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|