About (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate
(2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate (PubChem CID 19871399) has the molecular formula C25H30ClN3O4
and a molecular weight of 471.99 g/mol. Its IUPAC name is (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate.
Molecular Properties
| Compound Name | (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate |
| PubChem CID | 19871399 |
| Molecular Formula | C25H30ClN3O4 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OC2CCCCC2O)cc(-n2nc3ccc(Cl)cc3n2)c1O |
| InChI | InChI=1S/C25H30ClN3O4/c1-25(2,3)17-12-15(8-11-23(31)33-22-7-5-4-6-21(22)30)13-20(24(17)32)29-27-18-10-9-16(26)14-19(18)28-29/h9-10,12-14,21-22,30,32H,4-8,11H2,1-3H3 |
| InChIKey | YEMOKWSPHUEBOS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate?
The IUPAC name of (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate (CID 19871399) is (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate.
What is the SMILES notation for (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate?
The canonical SMILES for (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate is CC(C)(C)c1cc(CCC(=O)OC2CCCCC2O)cc(-n2nc3ccc(Cl)cc3n2)c1O.
What is the InChIKey of (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate?
The InChIKey is YEMOKWSPHUEBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30ClN3O4/c1-25(2,3)17-12-15(8-11-23(31)33-22-7-5-4-6-21(22)30)13-20(24(17)32)29-27-18-10-9-16(26)14-19(18)28-29/h9-10,12-14,21-22,30,32H,4-8,11H2,1-3H3.
What are the key properties of (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate?
(2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate has a molecular weight of 471.99 g/mol, XLogP of 4.86, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxycyclohexyl) 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate is sourced from PubChem (CID 19871399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).