C10H18N2O3 — CID 19871526
methyl carbonate;5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium (PubChem CID 19871526) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl carbonate;5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium.
| Compound Name | methyl carbonate;5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 19871526 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | methyl carbonate;5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium |
| SMILES | COC(=O)[O-].C[N+]12CCCN=C1CCC2 |
| InChI | InChI=1S/C8H15N2.C2H4O3/c1-10-6-2-4-8(10)9-5-3-7-10;1-5-2(3)4/h2-7H2,1H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | OHJONXZLBQKRPB-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|