About (Methylene)phosphinic acid
(Methylene)phosphinic acid (PubChem CID 19872324) has the molecular formula CH3O2P
and a molecular weight of 78.01 g/mol.
Molecular Properties
| Compound Name | (Methylene)phosphinic acid |
| PubChem CID | 19872324 |
| Molecular Formula | CH3O2P |
| Molecular Weight | 78.01 g/mol |
| Exact Mass | 77.99 |
| IUPAC Name | — |
| SMILES | C=[P+]([O-])O |
| InChI | InChI=1S/CH3O2P/c1-4(2)3/h1H2,(H,2,3) |
| InChIKey | LBYWTNBGUBZKJM-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.01 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Methylene)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Methylene)phosphinic acid?
The IUPAC name of (Methylene)phosphinic acid (CID 19872324) is not available.
What is the SMILES notation for (Methylene)phosphinic acid?
The canonical SMILES for (Methylene)phosphinic acid is C=[P+]([O-])O.
What is the InChIKey of (Methylene)phosphinic acid?
The InChIKey is LBYWTNBGUBZKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3O2P/c1-4(2)3/h1H2,(H,2,3).
What are the key properties of (Methylene)phosphinic acid?
(Methylene)phosphinic acid has a molecular weight of 78.01 g/mol, XLogP of -0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Methylene)phosphinic acid is sourced from PubChem (CID 19872324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).