About piperidin-4-yl prop-2-enoate
piperidin-4-yl prop-2-enoate (PubChem CID 19873492) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is piperidin-4-yl prop-2-enoate.
Molecular Properties
| Compound Name | piperidin-4-yl prop-2-enoate |
| PubChem CID | 19873492 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | piperidin-4-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1CCNCC1 |
| InChI | InChI=1S/C8H13NO2/c1-2-8(10)11-7-3-5-9-6-4-7/h2,7,9H,1,3-6H2 |
| InChIKey | BAFCGQFMIBAJCZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze piperidin-4-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl prop-2-enoate?
The IUPAC name of piperidin-4-yl prop-2-enoate (CID 19873492) is piperidin-4-yl prop-2-enoate.
What is the SMILES notation for piperidin-4-yl prop-2-enoate?
The canonical SMILES for piperidin-4-yl prop-2-enoate is C=CC(=O)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl prop-2-enoate?
The InChIKey is BAFCGQFMIBAJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-8(10)11-7-3-5-9-6-4-7/h2,7,9H,1,3-6H2.
What are the key properties of piperidin-4-yl prop-2-enoate?
piperidin-4-yl prop-2-enoate has a molecular weight of 155.20 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl prop-2-enoate is sourced from PubChem (CID 19873492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).