About 1,2,3,4-tetraisocyanatobutane
1,2,3,4-tetraisocyanatobutane (PubChem CID 19873495) has the molecular formula C8H6N4O4
and a molecular weight of 222.16 g/mol. Its IUPAC name is 1,2,3,4-tetraisocyanatobutane.
Molecular Properties
| Compound Name | 1,2,3,4-tetraisocyanatobutane |
| PubChem CID | 19873495 |
| Molecular Formula | C8H6N4O4 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 1,2,3,4-tetraisocyanatobutane |
| SMILES | O=C=NCC(N=C=O)C(CN=C=O)N=C=O |
| InChI | InChI=1S/C8H6N4O4/c13-3-9-1-7(11-5-15)8(12-6-16)2-10-4-14/h7-8H,1-2H2 |
| InChIKey | MGZPILVOXGOTMY-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3,4-tetraisocyanatobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetraisocyanatobutane?
The IUPAC name of 1,2,3,4-tetraisocyanatobutane (CID 19873495) is 1,2,3,4-tetraisocyanatobutane.
What is the SMILES notation for 1,2,3,4-tetraisocyanatobutane?
The canonical SMILES for 1,2,3,4-tetraisocyanatobutane is O=C=NCC(N=C=O)C(CN=C=O)N=C=O.
What is the InChIKey of 1,2,3,4-tetraisocyanatobutane?
The InChIKey is MGZPILVOXGOTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O4/c13-3-9-1-7(11-5-15)8(12-6-16)2-10-4-14/h7-8H,1-2H2.
What are the key properties of 1,2,3,4-tetraisocyanatobutane?
1,2,3,4-tetraisocyanatobutane has a molecular weight of 222.16 g/mol, XLogP of -0.93, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetraisocyanatobutane is sourced from PubChem (CID 19873495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).