About 1,2,3-triisocyanatobutane
1,2,3-triisocyanatobutane (PubChem CID 19873496) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is 1,2,3-triisocyanatobutane.
Molecular Properties
| Compound Name | 1,2,3-triisocyanatobutane |
| PubChem CID | 19873496 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 1,2,3-triisocyanatobutane |
| SMILES | CC(N=C=O)C(CN=C=O)N=C=O |
| InChI | InChI=1S/C7H7N3O3/c1-6(9-4-12)7(10-5-13)2-8-3-11/h6-7H,2H2,1H3 |
| InChIKey | HDSHTWXWLALHCZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-triisocyanatobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-triisocyanatobutane?
The IUPAC name of 1,2,3-triisocyanatobutane (CID 19873496) is 1,2,3-triisocyanatobutane.
What is the SMILES notation for 1,2,3-triisocyanatobutane?
The canonical SMILES for 1,2,3-triisocyanatobutane is CC(N=C=O)C(CN=C=O)N=C=O.
What is the InChIKey of 1,2,3-triisocyanatobutane?
The InChIKey is HDSHTWXWLALHCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3/c1-6(9-4-12)7(10-5-13)2-8-3-11/h6-7H,2H2,1H3.
What are the key properties of 1,2,3-triisocyanatobutane?
1,2,3-triisocyanatobutane has a molecular weight of 181.15 g/mol, XLogP of -0.25, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-triisocyanatobutane is sourced from PubChem (CID 19873496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).