About 1-nitroethane;1-nitropropane
1-nitroethane;1-nitropropane (PubChem CID 19873560) has the molecular formula C5H12N2O4
and a molecular weight of 164.16 g/mol. Its IUPAC name is 1-nitroethane;1-nitropropane.
Molecular Properties
| Compound Name | 1-nitroethane;1-nitropropane |
| PubChem CID | 19873560 |
| Molecular Formula | C5H12N2O4 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-nitroethane;1-nitropropane |
| SMILES | CCC[N+](=O)[O-].CC[N+](=O)[O-] |
| InChI | InChI=1S/C3H7NO2.C2H5NO2/c1-2-3-4(5)6;1-2-3(4)5/h2-3H2,1H3;2H2,1H3 |
| InChIKey | PPGZXJFDRCLUEP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroethane;1-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroethane;1-nitropropane?
The IUPAC name of 1-nitroethane;1-nitropropane (CID 19873560) is 1-nitroethane;1-nitropropane.
What is the SMILES notation for 1-nitroethane;1-nitropropane?
The canonical SMILES for 1-nitroethane;1-nitropropane is CCC[N+](=O)[O-].CC[N+](=O)[O-].
What is the InChIKey of 1-nitroethane;1-nitropropane?
The InChIKey is PPGZXJFDRCLUEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C2H5NO2/c1-2-3-4(5)6;1-2-3(4)5/h2-3H2,1H3;2H2,1H3.
What are the key properties of 1-nitroethane;1-nitropropane?
1-nitroethane;1-nitropropane has a molecular weight of 164.16 g/mol, XLogP of 0.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroethane;1-nitropropane is sourced from PubChem (CID 19873560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).