C17H16N2O4 — CID 19874452
ethyl 2-[2-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]acetate (PubChem CID 19874452) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 2-[2-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]acetate.
| Compound Name | ethyl 2-[2-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 19874452 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 2-[2-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1-c1cc(C#N)c(=O)[nH]c1C |
| InChI | InChI=1S/C17H16N2O4/c1-3-22-16(20)10-23-15-7-5-4-6-13(15)14-8-12(9-18)17(21)19-11(14)2/h4-8H,3,10H2,1-2H3,(H,19,21) |
| InChIKey | CRKVSGVMBWENDC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |