C12H10FNO — CID 19874640
7-fluoro-1,2,4b,9-tetrahydroindeno[2,1-b]pyridin-5-one (PubChem CID 19874640) has the molecular formula C12H10FNO and a molecular weight of 203.22 g/mol. Its IUPAC name is 7-fluoro-1,2,4b,9-tetrahydroindeno[2,1-b]pyridin-5-one.
| Compound Name | 7-fluoro-1,2,4b,9-tetrahydroindeno[2,1-b]pyridin-5-one |
|---|---|
| PubChem CID | 19874640 |
| Molecular Formula | C12H10FNO |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 7-fluoro-1,2,4b,9-tetrahydroindeno[2,1-b]pyridin-5-one |
| SMILES | O=C1C=C(F)C=C2CC3=C(C=CCN3)C12 |
| InChI | InChI=1S/C12H10FNO/c13-8-4-7-5-10-9(2-1-3-14-10)12(7)11(15)6-8/h1-2,4,6,12,14H,3,5H2 |
| InChIKey | YZKJALBUJMKLRX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |