About ethanamine;nitromethylsulfonylbenzene
ethanamine;nitromethylsulfonylbenzene (PubChem CID 19875086) has the molecular formula C9H14N2O4S
and a molecular weight of 246.29 g/mol. Its IUPAC name is ethanamine;nitromethylsulfonylbenzene.
Molecular Properties
| Compound Name | ethanamine;nitromethylsulfonylbenzene |
| PubChem CID | 19875086 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | ethanamine;nitromethylsulfonylbenzene |
| SMILES | CCN.O=[N+]([O-])CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO4S.C2H7N/c9-8(10)6-13(11,12)7-4-2-1-3-5-7;1-2-3/h1-5H,6H2;2-3H2,1H3 |
| InChIKey | HGTQJGUBYFDNIV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;nitromethylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;nitromethylsulfonylbenzene?
The IUPAC name of ethanamine;nitromethylsulfonylbenzene (CID 19875086) is ethanamine;nitromethylsulfonylbenzene.
What is the SMILES notation for ethanamine;nitromethylsulfonylbenzene?
The canonical SMILES for ethanamine;nitromethylsulfonylbenzene is CCN.O=[N+]([O-])CS(=O)(=O)c1ccccc1.
What is the InChIKey of ethanamine;nitromethylsulfonylbenzene?
The InChIKey is HGTQJGUBYFDNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4S.C2H7N/c9-8(10)6-13(11,12)7-4-2-1-3-5-7;1-2-3/h1-5H,6H2;2-3H2,1H3.
What are the key properties of ethanamine;nitromethylsulfonylbenzene?
ethanamine;nitromethylsulfonylbenzene has a molecular weight of 246.29 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;nitromethylsulfonylbenzene is sourced from PubChem (CID 19875086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).