C6H5F9O — CID 19875178
1,1,2,3,3,4,4,5,5-nonafluorohexan-1-ol (PubChem CID 19875178) has the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5-nonafluorohexan-1-ol.
| Compound Name | 1,1,2,3,3,4,4,5,5-nonafluorohexan-1-ol |
|---|---|
| PubChem CID | 19875178 |
| Molecular Formula | C6H5F9O |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5-nonafluorohexan-1-ol |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)C(O)(F)F |
| InChI | InChI=1S/C6H5F9O/c1-3(8,9)6(14,15)4(10,11)2(7)5(12,13)16/h2,16H,1H3 |
| InChIKey | JDXMTOLBKHGGRN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|