About 1,1-dihexylthiourea
1,1-dihexylthiourea (PubChem CID 19875492) has the molecular formula C13H28N2S
and a molecular weight of 244.45 g/mol. Its IUPAC name is 1,1-dihexylthiourea.
Molecular Properties
| Compound Name | 1,1-dihexylthiourea |
| PubChem CID | 19875492 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 1,1-dihexylthiourea |
| SMILES | CCCCCCN(CCCCCC)C(N)=S |
| InChI | InChI=1S/C13H28N2S/c1-3-5-7-9-11-15(13(14)16)12-10-8-6-4-2/h3-12H2,1-2H3,(H2,14,16) |
| InChIKey | JUHGAVAURDAEPH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dihexylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dihexylthiourea?
The IUPAC name of 1,1-dihexylthiourea (CID 19875492) is 1,1-dihexylthiourea.
What is the SMILES notation for 1,1-dihexylthiourea?
The canonical SMILES for 1,1-dihexylthiourea is CCCCCCN(CCCCCC)C(N)=S.
What is the InChIKey of 1,1-dihexylthiourea?
The InChIKey is JUHGAVAURDAEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2S/c1-3-5-7-9-11-15(13(14)16)12-10-8-6-4-2/h3-12H2,1-2H3,(H2,14,16).
What are the key properties of 1,1-dihexylthiourea?
1,1-dihexylthiourea has a molecular weight of 244.45 g/mol, XLogP of 3.69, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dihexylthiourea is sourced from PubChem (CID 19875492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).