C31H42Cl3NO5 — CID 19875705
[6-[2-(2,6-dichlorophenoxy)ethyl-propylamino]-1-(2,2-dimethylpropanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate;hydrochloride (PubChem CID 19875705) has the molecular formula C31H42Cl3NO5 and a molecular weight of 615.04 g/mol. Its IUPAC name is [6-[2-(2,6-dichlorophenoxy)ethyl-propylamino]-1-(2,2-dimethylpropanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate;hydrochloride.
| Compound Name | [6-[2-(2,6-dichlorophenoxy)ethyl-propylamino]-1-(2,2-dimethylpropanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 19875705 |
| Molecular Formula | C31H42Cl3NO5 |
| Molecular Weight | 615.04 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | [6-[2-(2,6-dichlorophenoxy)ethyl-propylamino]-1-(2,2-dimethylpropanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate;hydrochloride |
| SMILES | CCCN(CCOc1c(Cl)cccc1Cl)C1CCc2c(ccc(OC(=O)C(C)(C)C)c2OC(=O)C(C)(C)C)C1.Cl |
| InChI | InChI=1S/C31H41Cl2NO5.ClH/c1-8-16-34(17-18-37-27-23(32)10-9-11-24(27)33)21-13-14-22-20(19-21)12-15-25(38-28(35)30(2,3)4)26(22)39-29(36)31(5,6)7;/h9-12,15,21H,8,13-14,16-19H2,1-7H3;1H |
| InChIKey | UJIIPBNXMAPEDI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.04 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|