About 2-(1,3-thiazol-2-yl)acetamide
2-(1,3-thiazol-2-yl)acetamide (PubChem CID 19875792) has the molecular formula C5H6N2OS
and a molecular weight of 142.18 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 19875792 |
| Molecular Formula | C5H6N2OS |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)acetamide |
| SMILES | NC(=O)Cc1nccs1 |
| InChI | InChI=1S/C5H6N2OS/c6-4(8)3-5-7-1-2-9-5/h1-2H,3H2,(H2,6,8) |
| InChIKey | YMRBSBDRTKGFBG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(1,3-thiazol-2-yl)acetamide (CID 19875792) is 2-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(1,3-thiazol-2-yl)acetamide is NC(=O)Cc1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)acetamide?
The InChIKey is YMRBSBDRTKGFBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS/c6-4(8)3-5-7-1-2-9-5/h1-2H,3H2,(H2,6,8).
What are the key properties of 2-(1,3-thiazol-2-yl)acetamide?
2-(1,3-thiazol-2-yl)acetamide has a molecular weight of 142.18 g/mol, XLogP of 0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 19875792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).