C26H24ClN3O — CID 19875917
[4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 19875917) has the molecular formula C26H24ClN3O and a molecular weight of 429.95 g/mol. Its IUPAC name is [4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 19875917 |
| Molecular Formula | C26H24ClN3O |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | Cc1cnc2c(c1)CCc1cc(Cl)ccc1C2=C1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C26H24ClN3O/c1-17-14-21-3-2-20-15-22(27)4-5-23(20)24(25(21)29-16-17)18-8-12-30(13-9-18)26(31)19-6-10-28-11-7-19/h4-7,10-11,14-16H,2-3,8-9,12-13H2,1H3 |
| InChIKey | WIPZZBOCLPVZKT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |