About 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one
7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one (PubChem CID 19876009) has the molecular formula C10H10N2O3
and a molecular weight of 206.20 g/mol. Its IUPAC name is 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one |
| PubChem CID | 19876009 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one |
| SMILES | Cc1ccc2c(c1[N+](=O)[O-])NCCC2=O |
| InChI | InChI=1S/C10H10N2O3/c1-6-2-3-7-8(13)4-5-11-9(7)10(6)12(14)15/h2-3,11H,4-5H2,1H3 |
| InChIKey | ZWEYDGGZQGQMKY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one?
The IUPAC name of 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one (CID 19876009) is 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one.
What is the SMILES notation for 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one?
The canonical SMILES for 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one is Cc1ccc2c(c1[N+](=O)[O-])NCCC2=O.
What is the InChIKey of 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one?
The InChIKey is ZWEYDGGZQGQMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c1-6-2-3-7-8(13)4-5-11-9(7)10(6)12(14)15/h2-3,11H,4-5H2,1H3.
What are the key properties of 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one?
7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one has a molecular weight of 206.20 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-8-nitro-2,3-dihydro-1H-quinolin-4-one is sourced from PubChem (CID 19876009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).