About 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol
1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol (PubChem CID 19876171) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 19876171 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol |
| SMILES | Nc1ccc(C2(O)C=CC=CC2)cc1 |
| InChI | InChI=1S/C12H13NO/c13-11-6-4-10(5-7-11)12(14)8-2-1-3-9-12/h1-8,14H,9,13H2 |
| InChIKey | KITBENRDILPWSD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol (CID 19876171) is 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol is Nc1ccc(C2(O)C=CC=CC2)cc1.
What is the InChIKey of 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol?
The InChIKey is KITBENRDILPWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c13-11-6-4-10(5-7-11)12(14)8-2-1-3-9-12/h1-8,14H,9,13H2.
What are the key properties of 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol?
1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol has a molecular weight of 187.24 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminophenyl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 19876171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).