About (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate
(3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate (PubChem CID 19877237) has the molecular formula C24H28O4S
and a molecular weight of 412.55 g/mol. Its IUPAC name is (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate.
Molecular Properties
| Compound Name | (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate |
| PubChem CID | 19877237 |
| Molecular Formula | C24H28O4S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate |
| SMILES | CCC1(OC(C)=O)COC2(CC(c3ccccc3)SC(c3ccccc3)C2)OC1 |
| InChI | InChI=1S/C24H28O4S/c1-3-23(28-18(2)25)16-26-24(27-17-23)14-21(19-10-6-4-7-11-19)29-22(15-24)20-12-8-5-9-13-20/h4-13,21-22H,3,14-17H2,1-2H3 |
| InChIKey | RLTCQMFJFFQDGP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate?
The IUPAC name of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate (CID 19877237) is (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate.
What is the SMILES notation for (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate?
The canonical SMILES for (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate is CCC1(OC(C)=O)COC2(CC(c3ccccc3)SC(c3ccccc3)C2)OC1.
What is the InChIKey of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate?
The InChIKey is RLTCQMFJFFQDGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O4S/c1-3-23(28-18(2)25)16-26-24(27-17-23)14-21(19-10-6-4-7-11-19)29-22(15-24)20-12-8-5-9-13-20/h4-13,21-22H,3,14-17H2,1-2H3.
What are the key properties of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate?
(3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate has a molecular weight of 412.55 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl) acetate is sourced from PubChem (CID 19877237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).