About 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide
7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide (PubChem CID 19877238) has the molecular formula C19H20O3S
and a molecular weight of 328.43 g/mol. Its IUPAC name is 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide.
Molecular Properties
| Compound Name | 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide |
| PubChem CID | 19877238 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide |
| SMILES | O=S1C(c2ccccc2)CC2(CC1c1ccccc1)OCCO2 |
| InChI | InChI=1S/C19H20O3S/c20-23-17(15-7-3-1-4-8-15)13-19(21-11-12-22-19)14-18(23)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | RJXUETFORBQSOH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide?
The IUPAC name of 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide (CID 19877238) is 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide.
What is the SMILES notation for 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide?
The canonical SMILES for 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide is O=S1C(c2ccccc2)CC2(CC1c1ccccc1)OCCO2.
What is the InChIKey of 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide?
The InChIKey is RJXUETFORBQSOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O3S/c20-23-17(15-7-3-1-4-8-15)13-19(21-11-12-22-19)14-18(23)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2.
What are the key properties of 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide?
7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide has a molecular weight of 328.43 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-diphenyl-1,4-dioxa-8λ4-thiaspiro[4.5]decane 8-oxide is sourced from PubChem (CID 19877238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).