About (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate
(3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate (PubChem CID 19877244) has the molecular formula C29H38O4S
and a molecular weight of 482.69 g/mol. Its IUPAC name is (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate.
Molecular Properties
| Compound Name | (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate |
| PubChem CID | 19877244 |
| Molecular Formula | C29H38O4S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate |
| SMILES | CCCCCC(=O)OCC1(CC)COC2(CC(c3ccccc3)SC(c3ccccc3)C2)OC1 |
| InChI | InChI=1S/C29H38O4S/c1-3-5-8-17-27(30)31-20-28(4-2)21-32-29(33-22-28)18-25(23-13-9-6-10-14-23)34-26(19-29)24-15-11-7-12-16-24/h6-7,9-16,25-26H,3-5,8,17-22H2,1-2H3 |
| InChIKey | KTUIOOJCJJFSDZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate?
The IUPAC name of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate (CID 19877244) is (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate.
What is the SMILES notation for (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate?
The canonical SMILES for (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate is CCCCCC(=O)OCC1(CC)COC2(CC(c3ccccc3)SC(c3ccccc3)C2)OC1.
What is the InChIKey of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate?
The InChIKey is KTUIOOJCJJFSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H38O4S/c1-3-5-8-17-27(30)31-20-28(4-2)21-32-29(33-22-28)18-25(23-13-9-6-10-14-23)34-26(19-29)24-15-11-7-12-16-24/h6-7,9-16,25-26H,3-5,8,17-22H2,1-2H3.
What are the key properties of (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate?
(3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate has a molecular weight of 482.69 g/mol, XLogP of 7.26, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-8,10-diphenyl-1,5-dioxa-9-thiaspiro[5.5]undecan-3-yl)methyl hexanoate is sourced from PubChem (CID 19877244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).