About 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine
1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine (PubChem CID 19877442) has the molecular formula C19H28N2O3Si
and a molecular weight of 360.53 g/mol. Its IUPAC name is 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine.
Molecular Properties
| Compound Name | 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine |
| PubChem CID | 19877442 |
| Molecular Formula | C19H28N2O3Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine |
| SMILES | CO[Si](CCCNC(N)(c1ccccc1)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C19H28N2O3Si/c1-22-25(23-2,24-3)16-10-15-21-19(20,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,21H,10,15-16,20H2,1-3H3 |
| InChIKey | QNVWUAKZSXVHNP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine?
The IUPAC name of 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine (CID 19877442) is 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine.
What is the SMILES notation for 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine?
The canonical SMILES for 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine is CO[Si](CCCNC(N)(c1ccccc1)c1ccccc1)(OC)OC.
What is the InChIKey of 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine?
The InChIKey is QNVWUAKZSXVHNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3Si/c1-22-25(23-2,24-3)16-10-15-21-19(20,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,21H,10,15-16,20H2,1-3H3.
What are the key properties of 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine?
1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine has a molecular weight of 360.53 g/mol, XLogP of 2.70, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diphenyl-N'-(3-trimethoxysilylpropyl)methanediamine is sourced from PubChem (CID 19877442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).