About 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide
4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide (PubChem CID 19877520) has the molecular formula C18H22ClNO3
and a molecular weight of 335.83 g/mol. Its IUPAC name is 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide.
Molecular Properties
| Compound Name | 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide |
| PubChem CID | 19877520 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(O)c(Cl)c1.CC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H14O.C8H8ClNO2/c1-10(2,3)8-4-6-9(11)7-5-8;1-5(11)10-6-2-3-8(12)7(9)4-6/h4-7,11H,1-3H3;2-4,12H,1H3,(H,10,11) |
| InChIKey | NLVPYOCICYXHKD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide?
The IUPAC name of 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide (CID 19877520) is 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide.
What is the SMILES notation for 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide?
The canonical SMILES for 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide is CC(=O)Nc1ccc(O)c(Cl)c1.CC(C)(C)c1ccc(O)cc1.
What is the InChIKey of 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide?
The InChIKey is NLVPYOCICYXHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C8H8ClNO2/c1-10(2,3)8-4-6-9(11)7-5-8;1-5(11)10-6-2-3-8(12)7(9)4-6/h4-7,11H,1-3H3;2-4,12H,1H3,(H,10,11).
What are the key properties of 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide?
4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide has a molecular weight of 335.83 g/mol, XLogP of 4.69, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylphenol;N-(3-chloro-4-hydroxyphenyl)acetamide is sourced from PubChem (CID 19877520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).