About N-ethylethanamine;1-ethylpyrrole-2,5-dione
N-ethylethanamine;1-ethylpyrrole-2,5-dione (PubChem CID 19877873) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-ethylethanamine;1-ethylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | N-ethylethanamine;1-ethylpyrrole-2,5-dione |
| PubChem CID | 19877873 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-ethylethanamine;1-ethylpyrrole-2,5-dione |
| SMILES | CCN1C(=O)C=CC1=O.CCNCC |
| InChI | InChI=1S/C6H7NO2.C4H11N/c1-2-7-5(8)3-4-6(7)9;1-3-5-4-2/h3-4H,2H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | MURYJVKYSHHVIE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;1-ethylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;1-ethylpyrrole-2,5-dione?
The IUPAC name of N-ethylethanamine;1-ethylpyrrole-2,5-dione (CID 19877873) is N-ethylethanamine;1-ethylpyrrole-2,5-dione.
What is the SMILES notation for N-ethylethanamine;1-ethylpyrrole-2,5-dione?
The canonical SMILES for N-ethylethanamine;1-ethylpyrrole-2,5-dione is CCN1C(=O)C=CC1=O.CCNCC.
What is the InChIKey of N-ethylethanamine;1-ethylpyrrole-2,5-dione?
The InChIKey is MURYJVKYSHHVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C4H11N/c1-2-7-5(8)3-4-6(7)9;1-3-5-4-2/h3-4H,2H2,1H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;1-ethylpyrrole-2,5-dione?
N-ethylethanamine;1-ethylpyrrole-2,5-dione has a molecular weight of 198.27 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;1-ethylpyrrole-2,5-dione is sourced from PubChem (CID 19877873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).