C12H10N+ — CID 19877905
1-azoniatricyclo[7.3.1.05,13]trideca-1,3,5(13),6,8,11-hexaene (PubChem CID 19877905) has the molecular formula C12H10N+ and a molecular weight of 168.22 g/mol. Its IUPAC name is 1-azoniatricyclo[7.3.1.05,13]trideca-1,3,5(13),6,8,11-hexaene.
| Compound Name | 1-azoniatricyclo[7.3.1.05,13]trideca-1,3,5(13),6,8,11-hexaene |
|---|---|
| PubChem CID | 19877905 |
| Molecular Formula | C12H10N+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-azoniatricyclo[7.3.1.05,13]trideca-1,3,5(13),6,8,11-hexaene |
| SMILES | C1=C[n+]2cccc3cccc(c32)C1 |
| InChI | InChI=1S/C12H10N/c1-4-10-6-2-8-13-9-3-7-11(5-1)12(10)13/h1-6,8-9H,7H2/q+1 |
| InChIKey | LGWFYYQIAXZBAS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|