About (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid
(E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid (PubChem CID 19878114) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid.
Molecular Properties
| Compound Name | (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid |
| PubChem CID | 19878114 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid |
| SMILES | CC1(C)CC1C(=O)N/C(=C/CCCCCC#N)C(=O)O |
| InChI | InChI=1S/C15H22N2O3/c1-15(2)10-11(15)13(18)17-12(14(19)20)8-6-4-3-5-7-9-16/h8,11H,3-7,10H2,1-2H3,(H,17,18)(H,19,20)/b12-8+ |
| InChIKey | BPNOUXHRXBQREP-XYOKQWHBSA-N |
| XLogP | 2.59 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid?
The IUPAC name of (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid (CID 19878114) is (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid.
What is the SMILES notation for (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid?
The canonical SMILES for (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid is CC1(C)CC1C(=O)N/C(=C/CCCCCC#N)C(=O)O.
What is the InChIKey of (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid?
The InChIKey is BPNOUXHRXBQREP-XYOKQWHBSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-15(2)10-11(15)13(18)17-12(14(19)20)8-6-4-3-5-7-9-16/h8,11H,3-7,10H2,1-2H3,(H,17,18)(H,19,20)/b12-8+.
What are the key properties of (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid?
(E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid has a molecular weight of 278.35 g/mol, XLogP of 2.59, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-cyano-2-[(2,2-dimethylcyclopropanecarbonyl)amino]oct-2-enoic acid is sourced from PubChem (CID 19878114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).