About (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid
(E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid (PubChem CID 19878168) has the molecular formula C12H19NO3S
and a molecular weight of 257.35 g/mol. Its IUPAC name is (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid.
Molecular Properties
| Compound Name | (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid |
| PubChem CID | 19878168 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid |
| SMILES | CSCC/C=C(/NC(=O)C1CC1(C)C)C(=O)O |
| InChI | InChI=1S/C12H19NO3S/c1-12(2)7-8(12)10(14)13-9(11(15)16)5-4-6-17-3/h5,8H,4,6-7H2,1-3H3,(H,13,14)(H,15,16)/b9-5+ |
| InChIKey | GAKMGXCNBJOUDI-WEVVVXLNSA-N |
| XLogP | 1.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid?
The IUPAC name of (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid (CID 19878168) is (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid.
What is the SMILES notation for (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid?
The canonical SMILES for (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid is CSCC/C=C(/NC(=O)C1CC1(C)C)C(=O)O.
What is the InChIKey of (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid?
The InChIKey is GAKMGXCNBJOUDI-WEVVVXLNSA-N. The full InChI is InChI=1S/C12H19NO3S/c1-12(2)7-8(12)10(14)13-9(11(15)16)5-4-6-17-3/h5,8H,4,6-7H2,1-3H3,(H,13,14)(H,15,16)/b9-5+.
What are the key properties of (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid?
(E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid has a molecular weight of 257.35 g/mol, XLogP of 1.87, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-5-methylsulfanylpent-2-enoic acid is sourced from PubChem (CID 19878168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).