C24H40NO4P — CID 19878529
methyl 3-[3,5-ditert-butyl-4-[(4,4-diethyl-1,3,2-oxazaphospholidin-2-yl)oxy]phenyl]propanoate (PubChem CID 19878529) has the molecular formula C24H40NO4P and a molecular weight of 437.56 g/mol. Its IUPAC name is methyl 3-[3,5-ditert-butyl-4-[(4,4-diethyl-1,3,2-oxazaphospholidin-2-yl)oxy]phenyl]propanoate.
| Compound Name | methyl 3-[3,5-ditert-butyl-4-[(4,4-diethyl-1,3,2-oxazaphospholidin-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 19878529 |
| Molecular Formula | C24H40NO4P |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | methyl 3-[3,5-ditert-butyl-4-[(4,4-diethyl-1,3,2-oxazaphospholidin-2-yl)oxy]phenyl]propanoate |
| SMILES | CCC1(CC)COP(Oc2c(C(C)(C)C)cc(CCC(=O)OC)cc2C(C)(C)C)N1 |
| InChI | InChI=1S/C24H40NO4P/c1-10-24(11-2)16-28-30(25-24)29-21-18(22(3,4)5)14-17(12-13-20(26)27-9)15-19(21)23(6,7)8/h14-15,25H,10-13,16H2,1-9H3 |
| InChIKey | ITKCRQNYYGVMQJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|