About magnesium bis(4-nitrosophenolate)
magnesium bis(4-nitrosophenolate) (PubChem CID 19878561) has the molecular formula C12H8MgN2O4
and a molecular weight of 268.51 g/mol. Its IUPAC name is magnesium bis(4-nitrosophenolate).
Molecular Properties
| Compound Name | magnesium bis(4-nitrosophenolate) |
| PubChem CID | 19878561 |
| Molecular Formula | C12H8MgN2O4 |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | magnesium bis(4-nitrosophenolate) |
| SMILES | O=Nc1ccc([O-])cc1.O=Nc1ccc([O-])cc1.[Mg+2] |
| InChI | InChI=1S/2C6H5NO2.Mg/c2*8-6-3-1-5(7-9)2-4-6;/h2*1-4,8H;/q;;+2/p-2 |
| InChIKey | NQFWCFAFFMEOHO-UHFFFAOYSA-L |
| XLogP | 1.94 |
| TPSA | 104.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze magnesium bis(4-nitrosophenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(4-nitrosophenolate)?
The IUPAC name of magnesium bis(4-nitrosophenolate) (CID 19878561) is magnesium bis(4-nitrosophenolate).
What is the SMILES notation for magnesium bis(4-nitrosophenolate)?
The canonical SMILES for magnesium bis(4-nitrosophenolate) is O=Nc1ccc([O-])cc1.O=Nc1ccc([O-])cc1.[Mg+2].
What is the InChIKey of magnesium bis(4-nitrosophenolate)?
The InChIKey is NQFWCFAFFMEOHO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5NO2.Mg/c2*8-6-3-1-5(7-9)2-4-6;/h2*1-4,8H;/q;;+2/p-2.
What are the key properties of magnesium bis(4-nitrosophenolate)?
magnesium bis(4-nitrosophenolate) has a molecular weight of 268.51 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(4-nitrosophenolate) is sourced from PubChem (CID 19878561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).