C18H28O2 — CID 19879148
1-(6-hydroxy-6-methylhept-4-yn-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 19879148) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(6-hydroxy-6-methylhept-4-yn-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | 1-(6-hydroxy-6-methylhept-4-yn-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 19879148 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-(6-hydroxy-6-methylhept-4-yn-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | CC(CC#CC(C)(C)O)C1=CCC2C(O)CCCC12C |
| InChI | InChI=1S/C18H28O2/c1-13(7-5-11-17(2,3)20)14-9-10-15-16(19)8-6-12-18(14,15)4/h9,13,15-16,19-20H,6-8,10,12H2,1-4H3 |
| InChIKey | OVKBKXLYDZDOLJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|